C17H12F5NO — CID 71474180
2,3,4,5,6-pentafluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 71474180) has the molecular formula C17H12F5NO and a molecular weight of 341.28 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 71474180 |
| Molecular Formula | C17H12F5NO |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H12F5NO/c18-12-11(13(19)15(21)16(22)14(12)20)17(24)23-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2,(H,23,24) |
| InChIKey | BGNNEZFCSMNTIM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|