C12H20N+ — CID 144973609
ethane;[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium (PubChem CID 144973609) has the molecular formula C12H20N+ and a molecular weight of 178.30 g/mol. Its IUPAC name is ethane;[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium.
| Compound Name | ethane;[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
|---|---|
| PubChem CID | 144973609 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | ethane;[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
| SMILES | CC.[NH3+][C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13N.C2H6/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-2,4,6,10H,3,5,7,11H2;1-2H3/p+1/t10-;/m1./s1 |
| InChIKey | OPTZZELGEWUHHE-HNCPQSOCSA-O |
| XLogP | 2.33 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |