C11H15IN- — CID 166139472
N-methyliodanuidyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 166139472) has the molecular formula C11H15IN- and a molecular weight of 288.15 g/mol. Its IUPAC name is N-methyliodanuidyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-methyliodanuidyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 166139472 |
| Molecular Formula | C11H15IN- |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-methyliodanuidyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C[I-]NC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H15IN/c1-12-13-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,11,13H,4,6,8H2,1H3/q-1 |
| InChIKey | WYAOARZKCPVFOX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|