C11H15NO2S — CID 4650012
N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanesulfonamide (PubChem CID 4650012) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanesulfonamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanesulfonamide |
|---|---|
| PubChem CID | 4650012 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H15NO2S/c1-15(13,14)12-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,11-12H,4,6,8H2,1H3 |
| InChIKey | PJLDJGAXDCGWIQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |