C10H14N2O2S — CID 45117542
1-(sulfamoylamino)-1,2,3,4-tetrahydronaphthalene (PubChem CID 45117542) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(sulfamoylamino)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(sulfamoylamino)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 45117542 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(sulfamoylamino)-1,2,3,4-tetrahydronaphthalene |
| SMILES | NS(=O)(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C10H14N2O2S/c11-15(13,14)12-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10,12H,3,5,7H2,(H2,11,13,14) |
| InChIKey | XOSSFPWVLXQODA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |