C10H12NNaO3S — CID 67463776
sodium N-(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate (PubChem CID 67463776) has the molecular formula C10H12NNaO3S and a molecular weight of 249.27 g/mol. Its IUPAC name is sodium N-(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate.
| Compound Name | sodium N-(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate |
|---|---|
| PubChem CID | 67463776 |
| Molecular Formula | C10H12NNaO3S |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | sodium N-(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate |
| SMILES | O=S(=O)([O-])NC1CCCc2ccccc21.[Na+] |
| InChI | InChI=1S/C10H13NO3S.Na/c12-15(13,14)11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-2,4,6,10-11H,3,5,7H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | BQOKSEWTCDATAT-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|