C16H16FNO2S — CID 3325789
2-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide (PubChem CID 3325789) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3325789 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-fluoro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCc2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C16H16FNO2S/c17-14-9-3-4-11-16(14)21(19,20)18-15-10-5-7-12-6-1-2-8-13(12)15/h1-4,6,8-9,11,15,18H,5,7,10H2 |
| InChIKey | PVDOMPLBCMJSNP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |