C8H10N+ — CID 4235727
7-bicyclo[4.2.0]octa-1,3,5-trienylazanium (PubChem CID 4235727) has the molecular formula C8H10N+ and a molecular weight of 120.17 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-1,3,5-trienylazanium.
| Compound Name | 7-bicyclo[4.2.0]octa-1,3,5-trienylazanium |
|---|---|
| PubChem CID | 4235727 |
| Molecular Formula | C8H10N+ |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-1,3,5-trienylazanium |
| SMILES | [NH3+]C1Cc2ccccc21 |
| InChI | InChI=1S/C8H9N/c9-8-5-6-3-1-2-4-7(6)8/h1-4,8H,5,9H2/p+1 |
| InChIKey | OVLLQUKHPTXIBH-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |