C9H9Br — CID 65438345
7-(bromomethyl)bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 65438345) has the molecular formula C9H9Br and a molecular weight of 197.07 g/mol. Its IUPAC name is 7-(bromomethyl)bicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-(bromomethyl)bicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 65438345 |
| Molecular Formula | C9H9Br |
| Molecular Weight | 197.07 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 7-(bromomethyl)bicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | BrCC1Cc2ccccc21 |
| InChI | InChI=1S/C9H9Br/c10-6-8-5-7-3-1-2-4-9(7)8/h1-4,8H,5-6H2 |
| InChIKey | DKGHEEFGNFGYNL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.07 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|