C10H14N2 — CID 105220809
2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine (PubChem CID 105220809) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine |
|---|---|
| PubChem CID | 105220809 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine |
| SMILES | NNCCC1Cc2ccccc21 |
| InChI | InChI=1S/C10H14N2/c11-12-6-5-9-7-8-3-1-2-4-10(8)9/h1-4,9,12H,5-7,11H2 |
| InChIKey | AAPQCFGRRFYKNQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|