C18H20N2 — CID 105224824
1,2-bis(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine (PubChem CID 105224824) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1,2-bis(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine.
| Compound Name | 1,2-bis(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine |
|---|---|
| PubChem CID | 105224824 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1,2-bis(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylhydrazine |
| SMILES | NNC(CC1Cc2ccccc21)C1Cc2ccccc21 |
| InChI | InChI=1S/C18H20N2/c19-20-18(17-10-13-6-2-4-8-16(13)17)11-14-9-12-5-1-3-7-15(12)14/h1-8,14,17-18,20H,9-11,19H2 |
| InChIKey | IGILHPNBERLANN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|