C14H18N2 — CID 105224756
1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-5-ynylhydrazine (PubChem CID 105224756) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-5-ynylhydrazine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-5-ynylhydrazine |
|---|---|
| PubChem CID | 105224756 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-5-ynylhydrazine |
| SMILES | C#CCCCC(NN)C1Cc2ccccc21 |
| InChI | InChI=1S/C14H18N2/c1-2-3-4-9-14(16-15)13-10-11-7-5-6-8-12(11)13/h1,5-8,13-14,16H,3-4,9-10,15H2 |
| InChIKey | WDZFWOGUEWEXHF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|