C14H18N2O — CID 105262710
1-(2,3-dihydro-1-benzofuran-3-yl)hex-5-ynylhydrazine (PubChem CID 105262710) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-3-yl)hex-5-ynylhydrazine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-3-yl)hex-5-ynylhydrazine |
|---|---|
| PubChem CID | 105262710 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-3-yl)hex-5-ynylhydrazine |
| SMILES | C#CCCCC(NN)C1COc2ccccc21 |
| InChI | InChI=1S/C14H18N2O/c1-2-3-4-8-13(16-15)12-10-17-14-9-6-5-7-11(12)14/h1,5-7,9,12-13,16H,3-4,8,10,15H2 |
| InChIKey | SBFVXHQYFOZWCS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|