C17H28N4 — CID 105261327
[2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine (PubChem CID 105261327) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine.
| Compound Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105261327 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(CC2Cc3ccccc32)NN)C1 |
| InChI | InChI=1S/C17H28N4/c1-20-8-5-9-21(2)17(12-20)16(19-18)11-14-10-13-6-3-4-7-15(13)14/h3-4,6-7,14,16-17,19H,5,8-12,18H2,1-2H3 |
| InChIKey | BUNYZRWOOLRMTB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|