C12H28N4 — CID 105261145
1-(1,4-dimethyl-1,4-diazepan-2-yl)pentylhydrazine (PubChem CID 105261145) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-(1,4-dimethyl-1,4-diazepan-2-yl)pentylhydrazine.
| Compound Name | 1-(1,4-dimethyl-1,4-diazepan-2-yl)pentylhydrazine |
|---|---|
| PubChem CID | 105261145 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 1-(1,4-dimethyl-1,4-diazepan-2-yl)pentylhydrazine |
| SMILES | CCCCC(NN)C1CN(C)CCCN1C |
| InChI | InChI=1S/C12H28N4/c1-4-5-7-11(14-13)12-10-15(2)8-6-9-16(12)3/h11-12,14H,4-10,13H2,1-3H3 |
| InChIKey | ZCORZTXLZOQOLT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|