C14H29N7 — CID 105261324
[1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105261324) has the molecular formula C14H29N7 and a molecular weight of 295.44 g/mol. Its IUPAC name is [1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105261324 |
| Molecular Formula | C14H29N7 |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)C1CN(C)CCCN1C |
| InChI | InChI=1S/C14H29N7/c1-4-6-21-14(16-11-17-21)9-12(18-15)13-10-19(2)7-5-8-20(13)3/h11-13,18H,4-10,15H2,1-3H3 |
| InChIKey | LPYINWSBUYKHOM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|