C15H24F2N4 — CID 105261363
[2-(2,6-difluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine (PubChem CID 105261363) has the molecular formula C15H24F2N4 and a molecular weight of 298.38 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,6-difluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105261363 |
| Molecular Formula | C15H24F2N4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [2-(2,6-difluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(Cc2c(F)cccc2F)NN)C1 |
| InChI | InChI=1S/C15H24F2N4/c1-20-7-4-8-21(2)15(10-20)14(19-18)9-11-12(16)5-3-6-13(11)17/h3,5-6,14-15,19H,4,7-10,18H2,1-2H3 |
| InChIKey | NUYLMUGBNNTTIT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|