C14H23FN4 — CID 105261273
[(1,4-dimethyl-1,4-diazepan-2-yl)-(4-fluorophenyl)methyl]hydrazine (PubChem CID 105261273) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is [(1,4-dimethyl-1,4-diazepan-2-yl)-(4-fluorophenyl)methyl]hydrazine.
| Compound Name | [(1,4-dimethyl-1,4-diazepan-2-yl)-(4-fluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105261273 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [(1,4-dimethyl-1,4-diazepan-2-yl)-(4-fluorophenyl)methyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(NN)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H23FN4/c1-18-8-3-9-19(2)13(10-18)14(17-16)11-4-6-12(15)7-5-11/h4-7,13-14,17H,3,8-10,16H2,1-2H3 |
| InChIKey | OVYRYSYTKUMSJC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|