C13H24N4S — CID 105261282
[(1,4-dimethyl-1,4-diazepan-2-yl)-(3-methylthiophen-2-yl)methyl]hydrazine (PubChem CID 105261282) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is [(1,4-dimethyl-1,4-diazepan-2-yl)-(3-methylthiophen-2-yl)methyl]hydrazine.
| Compound Name | [(1,4-dimethyl-1,4-diazepan-2-yl)-(3-methylthiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105261282 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(1,4-dimethyl-1,4-diazepan-2-yl)-(3-methylthiophen-2-yl)methyl]hydrazine |
| SMILES | Cc1ccsc1C(NN)C1CN(C)CCCN1C |
| InChI | InChI=1S/C13H24N4S/c1-10-5-8-18-13(10)12(15-14)11-9-16(2)6-4-7-17(11)3/h5,8,11-12,15H,4,6-7,9,14H2,1-3H3 |
| InChIKey | SIEPUURFZPAHPR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|