C12H21BrN4S — CID 105261189
[(4-bromothiophen-3-yl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine (PubChem CID 105261189) has the molecular formula C12H21BrN4S and a molecular weight of 333.30 g/mol. Its IUPAC name is [(4-bromothiophen-3-yl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine.
| Compound Name | [(4-bromothiophen-3-yl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105261189 |
| Molecular Formula | C12H21BrN4S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [(4-bromothiophen-3-yl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(NN)c2cscc2Br)C1 |
| InChI | InChI=1S/C12H21BrN4S/c1-16-4-3-5-17(2)11(6-16)12(15-14)9-7-18-8-10(9)13/h7-8,11-12,15H,3-6,14H2,1-2H3 |
| InChIKey | HNQYIIHVYLFREM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|