C14H22BrClN4 — CID 114269213
[(2-bromo-6-chlorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine (PubChem CID 114269213) has the molecular formula C14H22BrClN4 and a molecular weight of 361.72 g/mol. Its IUPAC name is [(2-bromo-6-chlorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine.
| Compound Name | [(2-bromo-6-chlorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114269213 |
| Molecular Formula | C14H22BrClN4 |
| Molecular Weight | 361.72 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [(2-bromo-6-chlorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(NN)c2c(Cl)cccc2Br)C1 |
| InChI | InChI=1S/C14H22BrClN4/c1-19-7-4-8-20(2)12(9-19)14(18-17)13-10(15)5-3-6-11(13)16/h3,5-6,12,14,18H,4,7-9,17H2,1-2H3 |
| InChIKey | WFJFSLOAGODNSG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|