C17H30N4 — CID 105261179
[(1,4-dimethyl-1,4-diazepan-2-yl)-(4-propylphenyl)methyl]hydrazine (PubChem CID 105261179) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is [(1,4-dimethyl-1,4-diazepan-2-yl)-(4-propylphenyl)methyl]hydrazine.
| Compound Name | [(1,4-dimethyl-1,4-diazepan-2-yl)-(4-propylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105261179 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | [(1,4-dimethyl-1,4-diazepan-2-yl)-(4-propylphenyl)methyl]hydrazine |
| SMILES | CCCc1ccc(C(NN)C2CN(C)CCCN2C)cc1 |
| InChI | InChI=1S/C17H30N4/c1-4-6-14-7-9-15(10-8-14)17(19-18)16-13-20(2)11-5-12-21(16)3/h7-10,16-17,19H,4-6,11-13,18H2,1-3H3 |
| InChIKey | AAIJFYWZTVGVPY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|