C15H24ClFN4 — CID 107895279
[2-(4-chloro-3-fluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine (PubChem CID 107895279) has the molecular formula C15H24ClFN4 and a molecular weight of 314.84 g/mol. Its IUPAC name is [2-(4-chloro-3-fluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-3-fluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107895279 |
| Molecular Formula | C15H24ClFN4 |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [2-(4-chloro-3-fluorophenyl)-1-(1,4-dimethyl-1,4-diazepan-2-yl)ethyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(Cc2ccc(Cl)c(F)c2)NN)C1 |
| InChI | InChI=1S/C15H24ClFN4/c1-20-6-3-7-21(2)15(10-20)14(19-18)9-11-4-5-12(16)13(17)8-11/h4-5,8,14-15,19H,3,6-7,9-10,18H2,1-2H3 |
| InChIKey | BUCFGZNZOURUDI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|