C15H30N6 — CID 105239944
[3-methyl-3-piperidin-1-yl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine (PubChem CID 105239944) has the molecular formula C15H30N6 and a molecular weight of 294.45 g/mol. Its IUPAC name is [3-methyl-3-piperidin-1-yl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine.
| Compound Name | [3-methyl-3-piperidin-1-yl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105239944 |
| Molecular Formula | C15H30N6 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | [3-methyl-3-piperidin-1-yl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C15H30N6/c1-4-8-21-14(17-12-18-21)11-13(19-16)15(2,3)20-9-6-5-7-10-20/h12-13,19H,4-11,16H2,1-3H3 |
| InChIKey | BIMOMMSAYXGLDI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|