C14H28N6 — CID 105242143
[3-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)-3-pyrrolidin-1-ylpentan-2-yl]hydrazine (PubChem CID 105242143) has the molecular formula C14H28N6 and a molecular weight of 280.42 g/mol. Its IUPAC name is [3-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)-3-pyrrolidin-1-ylpentan-2-yl]hydrazine.
| Compound Name | [3-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)-3-pyrrolidin-1-ylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105242143 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | [3-ethyl-1-(2-methyl-1,2,4-triazol-3-yl)-3-pyrrolidin-1-ylpentan-2-yl]hydrazine |
| SMILES | CCC(CC)(C(Cc1ncnn1C)NN)N1CCCC1 |
| InChI | InChI=1S/C14H28N6/c1-4-14(5-2,20-8-6-7-9-20)12(18-15)10-13-16-11-17-19(13)3/h11-12,18H,4-10,15H2,1-3H3 |
| InChIKey | PMSPLENFIVFGIB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|