C12H25N5 — CID 105317424
[3,3-dimethyl-1-(2-propan-2-yl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine (PubChem CID 105317424) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is [3,3-dimethyl-1-(2-propan-2-yl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine.
| Compound Name | [3,3-dimethyl-1-(2-propan-2-yl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105317424 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | [3,3-dimethyl-1-(2-propan-2-yl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine |
| SMILES | CCC(C)(C)C(Cc1ncnn1C(C)C)NN |
| InChI | InChI=1S/C12H25N5/c1-6-12(4,5)10(16-13)7-11-14-8-15-17(11)9(2)3/h8-10,16H,6-7,13H2,1-5H3 |
| InChIKey | XHMFMJMJIPHJAI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|