C14H30N6 — CID 105239377
N,N-diethyl-3-hydrazinyl-2-methyl-4-(2-propan-2-yl-1,2,4-triazol-3-yl)butan-2-amine (PubChem CID 105239377) has the molecular formula C14H30N6 and a molecular weight of 282.44 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-2-methyl-4-(2-propan-2-yl-1,2,4-triazol-3-yl)butan-2-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(2-propan-2-yl-1,2,4-triazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 105239377 |
| Molecular Formula | C14H30N6 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(2-propan-2-yl-1,2,4-triazol-3-yl)butan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(Cc1ncnn1C(C)C)NN |
| InChI | InChI=1S/C14H30N6/c1-7-19(8-2)14(5,6)12(18-15)9-13-16-10-17-20(13)11(3)4/h10-12,18H,7-9,15H2,1-6H3 |
| InChIKey | ZHYGMRLSSSZUHU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|