C15H31N5 — CID 105239181
N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-propan-2-ylpyrazol-3-yl)butan-2-amine (PubChem CID 105239181) has the molecular formula C15H31N5 and a molecular weight of 281.45 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-propan-2-ylpyrazol-3-yl)butan-2-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-propan-2-ylpyrazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 105239181 |
| Molecular Formula | C15H31N5 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.26 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-propan-2-ylpyrazol-3-yl)butan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(Cc1ccn(C(C)C)n1)NN |
| InChI | InChI=1S/C15H31N5/c1-7-19(8-2)15(5,6)14(17-16)11-13-9-10-20(18-13)12(3)4/h9-10,12,14,17H,7-8,11,16H2,1-6H3 |
| InChIKey | LFMQGUXCHCKOFQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|