C17H26N4 — CID 105216281
[3-methyl-3-phenyl-1-(1-propan-2-ylpyrazol-3-yl)butan-2-yl]hydrazine (PubChem CID 105216281) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is [3-methyl-3-phenyl-1-(1-propan-2-ylpyrazol-3-yl)butan-2-yl]hydrazine.
| Compound Name | [3-methyl-3-phenyl-1-(1-propan-2-ylpyrazol-3-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105216281 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | [3-methyl-3-phenyl-1-(1-propan-2-ylpyrazol-3-yl)butan-2-yl]hydrazine |
| SMILES | CC(C)n1ccc(CC(NN)C(C)(C)c2ccccc2)n1 |
| InChI | InChI=1S/C17H26N4/c1-13(2)21-11-10-15(20-21)12-16(19-18)17(3,4)14-8-6-5-7-9-14/h5-11,13,16,19H,12,18H2,1-4H3 |
| InChIKey | FMVSKNVBTXAVDM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|