C17H22N2 — CID 105216261
(3-methyl-1,3-diphenylbutan-2-yl)hydrazine (PubChem CID 105216261) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (3-methyl-1,3-diphenylbutan-2-yl)hydrazine.
| Compound Name | (3-methyl-1,3-diphenylbutan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105216261 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (3-methyl-1,3-diphenylbutan-2-yl)hydrazine |
| SMILES | CC(C)(c1ccccc1)C(Cc1ccccc1)NN |
| InChI | InChI=1S/C17H22N2/c1-17(2,15-11-7-4-8-12-15)16(19-18)13-14-9-5-3-6-10-14/h3-12,16,19H,13,18H2,1-2H3 |
| InChIKey | QSJYGPQXXCSJRV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|