C17H20ClFN2 — CID 103043854
[1-(3-chloro-4-fluorophenyl)-3-methyl-3-phenylbutan-2-yl]hydrazine (PubChem CID 103043854) has the molecular formula C17H20ClFN2 and a molecular weight of 306.81 g/mol. Its IUPAC name is [1-(3-chloro-4-fluorophenyl)-3-methyl-3-phenylbutan-2-yl]hydrazine.
| Compound Name | [1-(3-chloro-4-fluorophenyl)-3-methyl-3-phenylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103043854 |
| Molecular Formula | C17H20ClFN2 |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | [1-(3-chloro-4-fluorophenyl)-3-methyl-3-phenylbutan-2-yl]hydrazine |
| SMILES | CC(C)(c1ccccc1)C(Cc1ccc(F)c(Cl)c1)NN |
| InChI | InChI=1S/C17H20ClFN2/c1-17(2,13-6-4-3-5-7-13)16(21-20)11-12-8-9-15(19)14(18)10-12/h3-10,16,21H,11,20H2,1-2H3 |
| InChIKey | LTFLSSPANBMNNT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|