C17H21N — CID 63086399
3-methyl-1,3-diphenylbutan-2-amine (PubChem CID 63086399) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-methyl-1,3-diphenylbutan-2-amine.
| Compound Name | 3-methyl-1,3-diphenylbutan-2-amine |
|---|---|
| PubChem CID | 63086399 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-methyl-1,3-diphenylbutan-2-amine |
| SMILES | CC(C)(c1ccccc1)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C17H21N/c1-17(2,15-11-7-4-8-12-15)16(18)13-14-9-5-3-6-10-14/h3-12,16H,13,18H2,1-2H3 |
| InChIKey | OUGHGFBAWPFYPA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |