C23H25NO — CID 101072833
(2S)-2-amino-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol (PubChem CID 101072833) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (2S)-2-amino-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-amino-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101072833 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2S)-2-amino-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO/c1-17-8-12-20(13-9-17)23(25,21-14-10-18(2)11-15-21)22(24)16-19-6-4-3-5-7-19/h3-15,22,25H,16,24H2,1-2H3/t22-/m0/s1 |
| InChIKey | ZNOVCUROOVMNMO-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |