C19H25NO — CID 18640444
(2S)-2-amino-3-methyl-1,1-bis(4-methylphenyl)butan-1-ol (PubChem CID 18640444) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-1,1-bis(4-methylphenyl)butan-1-ol.
| Compound Name | (2S)-2-amino-3-methyl-1,1-bis(4-methylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 18640444 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (2S)-2-amino-3-methyl-1,1-bis(4-methylphenyl)butan-1-ol |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@@H](N)C(C)C)cc1 |
| InChI | InChI=1S/C19H25NO/c1-13(2)18(20)19(21,16-9-5-14(3)6-10-16)17-11-7-15(4)8-12-17/h5-13,18,21H,20H2,1-4H3/t18-/m0/s1 |
| InChIKey | PDPRPBDFNNXYAB-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |