C40H48N2O4 — CID 69006626
N,N'-bis[(2R)-1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]oxamide (PubChem CID 69006626) has the molecular formula C40H48N2O4 and a molecular weight of 620.83 g/mol. Its IUPAC name is N,N'-bis[(2R)-1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]oxamide.
| Compound Name | N,N'-bis[(2R)-1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]oxamide |
|---|---|
| PubChem CID | 69006626 |
| Molecular Formula | C40H48N2O4 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | N,N'-bis[(2R)-1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]oxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@H](NC(=O)C(=O)N[C@H](C(C)C)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C40H48N2O4/c1-25(2)35(39(45,31-17-9-27(5)10-18-31)32-19-11-28(6)12-20-32)41-37(43)38(44)42-36(26(3)4)40(46,33-21-13-29(7)14-22-33)34-23-15-30(8)16-24-34/h9-26,35-36,45-46H,1-8H3,(H,41,43)(H,42,44)/t35-,36-/m1/s1 |
| InChIKey | FHAMLHROWHTJIR-LQFQNGICSA-N |
| XLogP | 6.37 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|