C45H56N2O4 — CID 66923949
1-N,1-N'-bis[(2R)-1-hydroxy-3,3-dimethyl-1,1-bis(4-methylphenyl)butan-2-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 66923949) has the molecular formula C45H56N2O4 and a molecular weight of 688.95 g/mol. Its IUPAC name is 1-N,1-N'-bis[(2R)-1-hydroxy-3,3-dimethyl-1,1-bis(4-methylphenyl)butan-2-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(2R)-1-hydroxy-3,3-dimethyl-1,1-bis(4-methylphenyl)butan-2-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923949 |
| Molecular Formula | C45H56N2O4 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.42 |
| IUPAC Name | 1-N,1-N'-bis[(2R)-1-hydroxy-3,3-dimethyl-1,1-bis(4-methylphenyl)butan-2-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@H](NC(=O)C2(C(=O)N[C@H](C(C)(C)C)C(O)(c3ccc(C)cc3)c3ccc(C)cc3)CC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C45H56N2O4/c1-29-11-19-33(20-12-29)44(50,34-21-13-30(2)14-22-34)37(41(5,6)7)46-39(48)43(27-28-43)40(49)47-38(42(8,9)10)45(51,35-23-15-31(3)16-24-35)36-25-17-32(4)18-26-36/h11-26,37-38,50-51H,27-28H2,1-10H3,(H,46,48)(H,47,49)/t37-,38-/m1/s1 |
| InChIKey | NIBXLLMDTDAVIS-XPSQVAKYSA-N |
| XLogP | 7.93 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|