C47H44N2O4 — CID 66923555
1-N,1-N'-bis[(2R)-1-hydroxy-1,1,3-triphenylpropan-2-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 66923555) has the molecular formula C47H44N2O4 and a molecular weight of 700.88 g/mol. Its IUPAC name is 1-N,1-N'-bis[(2R)-1-hydroxy-1,1,3-triphenylpropan-2-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(2R)-1-hydroxy-1,1,3-triphenylpropan-2-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923555 |
| Molecular Formula | C47H44N2O4 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | 1-N,1-N'-bis[(2R)-1-hydroxy-1,1,3-triphenylpropan-2-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1)C1(C(=O)N[C@H](Cc2ccccc2)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C47H44N2O4/c50-43(48-41(33-35-19-7-1-8-20-35)46(52,37-23-11-3-12-24-37)38-25-13-4-14-26-38)45(31-32-45)44(51)49-42(34-36-21-9-2-10-22-36)47(53,39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,41-42,52-53H,31-34H2,(H,48,50)(H,49,51)/t41-,42-/m1/s1 |
| InChIKey | GETMDJKBHXFXJL-NCRNUEESSA-N |
| XLogP | 7.09 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|