C46H58N2O4 — CID 66923843
1-N,1-N'-bis[(3R)-2-benzyl-2-hydroxy-5-methyl-1-phenylhexan-3-yl]cyclobutane-1,1-dicarboxamide (PubChem CID 66923843) has the molecular formula C46H58N2O4 and a molecular weight of 702.98 g/mol. Its IUPAC name is 1-N,1-N'-bis[(3R)-2-benzyl-2-hydroxy-5-methyl-1-phenylhexan-3-yl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(3R)-2-benzyl-2-hydroxy-5-methyl-1-phenylhexan-3-yl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923843 |
| Molecular Formula | C46H58N2O4 |
| Molecular Weight | 702.98 g/mol |
| Exact Mass | 702.44 |
| IUPAC Name | 1-N,1-N'-bis[(3R)-2-benzyl-2-hydroxy-5-methyl-1-phenylhexan-3-yl]cyclobutane-1,1-dicarboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)C1(C(=O)N[C@H](CC(C)C)C(O)(Cc2ccccc2)Cc2ccccc2)CCC1)C(O)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C46H58N2O4/c1-34(2)28-40(45(51,30-36-18-9-5-10-19-36)31-37-20-11-6-12-21-37)47-42(49)44(26-17-27-44)43(50)48-41(29-35(3)4)46(52,32-38-22-13-7-14-23-38)33-39-24-15-8-16-25-39/h5-16,18-25,34-35,40-41,51-52H,17,26-33H2,1-4H3,(H,47,49)(H,48,50)/t40-,41-/m1/s1 |
| InChIKey | NQQHMPBTIXQGGV-GYOJGHLZSA-N |
| XLogP | 7.65 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.98 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|