C20H38N2O4 — CID 23141188
1-N,1-N'-bis(1-hydroxy-4-methylpentan-2-yl)cyclohexane-1,1-dicarboxamide (PubChem CID 23141188) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is 1-N,1-N'-bis(1-hydroxy-4-methylpentan-2-yl)cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis(1-hydroxy-4-methylpentan-2-yl)cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 23141188 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 1-N,1-N'-bis(1-hydroxy-4-methylpentan-2-yl)cyclohexane-1,1-dicarboxamide |
| SMILES | CC(C)CC(CO)NC(=O)C1(C(=O)NC(CO)CC(C)C)CCCCC1 |
| InChI | InChI=1S/C20H38N2O4/c1-14(2)10-16(12-23)21-18(25)20(8-6-5-7-9-20)19(26)22-17(13-24)11-15(3)4/h14-17,23-24H,5-13H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | ISSADJUUOIYGRY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|