C16H22ClNO2 — CID 11543898
1-(4-chlorophenyl)-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopropane-1-carboxamide (PubChem CID 11543898) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11543898 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)C[C@H](CO)NC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClNO2/c1-11(2)9-14(10-19)18-15(20)16(7-8-16)12-3-5-13(17)6-4-12/h3-6,11,14,19H,7-10H2,1-2H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | SCLZMPSRNDBNPC-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |