C16H15ClF3NO — CID 154764723
1-(4-chlorophenyl)-N-(1,1,1-trifluorohex-5-yn-3-yl)cyclopropane-1-carboxamide (PubChem CID 154764723) has the molecular formula C16H15ClF3NO and a molecular weight of 329.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(1,1,1-trifluorohex-5-yn-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(1,1,1-trifluorohex-5-yn-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 154764723 |
| Molecular Formula | C16H15ClF3NO |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(1,1,1-trifluorohex-5-yn-3-yl)cyclopropane-1-carboxamide |
| SMILES | C#CCC(CC(F)(F)F)NC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H15ClF3NO/c1-2-3-13(10-16(18,19)20)21-14(22)15(8-9-15)11-4-6-12(17)7-5-11/h1,4-7,13H,3,8-10H2,(H,21,22) |
| InChIKey | QSFLTRJBVPCLDH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|