C15H16N2O3 — CID 115913879
2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]pent-4-ynoic acid (PubChem CID 115913879) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]pent-4-ynoic acid.
| Compound Name | 2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 115913879 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)C1(c2ccc(N)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C15H16N2O3/c1-2-3-12(13(18)19)17-14(20)15(8-9-15)10-4-6-11(16)7-5-10/h1,4-7,12H,3,8-9,16H2,(H,17,20)(H,18,19) |
| InChIKey | TWGVQMJWDRIZNQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|