C14H15FN2O4 — CID 107821490
(2R)-4-amino-2-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-4-oxobutanoic acid (PubChem CID 107821490) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is (2R)-4-amino-2-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107821490 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R)-4-amino-2-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)C1(c2ccc(F)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C14H15FN2O4/c15-9-3-1-8(2-4-9)14(5-6-14)13(21)17-10(12(19)20)7-11(16)18/h1-4,10H,5-7H2,(H2,16,18)(H,17,21)(H,19,20)/t10-/m1/s1 |
| InChIKey | RTLDJPVHDVONOH-SNVBAGLBSA-N |
| XLogP | 0.30 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |