C14H18N2O4 — CID 107824796
(2S)-2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]-4-hydroxybutanoic acid (PubChem CID 107824796) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2S)-2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107824796 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S)-2-[[1-(4-aminophenyl)cyclopropanecarbonyl]amino]-4-hydroxybutanoic acid |
| SMILES | Nc1ccc(C2(C(=O)N[C@@H](CCO)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C14H18N2O4/c15-10-3-1-9(2-4-10)14(6-7-14)13(20)16-11(5-8-17)12(18)19/h1-4,11,17H,5-8,15H2,(H,16,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | JZRHOWAKGZDIMY-NSHDSACASA-N |
| XLogP | 0.25 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|