C15H18BrNO3S — CID 104906047
(2R)-2-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 104906047) has the molecular formula C15H18BrNO3S and a molecular weight of 372.28 g/mol. Its IUPAC name is (2R)-2-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104906047 |
| Molecular Formula | C15H18BrNO3S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | (2R)-2-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)C1(c2ccc(Br)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C15H18BrNO3S/c1-21-9-6-12(13(18)19)17-14(20)15(7-8-15)10-2-4-11(16)5-3-10/h2-5,12H,6-9H2,1H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | HLMXHEKJFDKKLN-GFCCVEGCSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |