C12H13BrClNO3S — CID 93302632
(2R)-2-[(5-bromo-2-chlorobenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 93302632) has the molecular formula C12H13BrClNO3S and a molecular weight of 366.66 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-2-chlorobenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(5-bromo-2-chlorobenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 93302632 |
| Molecular Formula | C12H13BrClNO3S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | (2R)-2-[(5-bromo-2-chlorobenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)c1cc(Br)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13BrClNO3S/c1-19-5-4-10(12(17)18)15-11(16)8-6-7(13)2-3-9(8)14/h2-3,6,10H,4-5H2,1H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | PZLSXHKEKYWPTP-SNVBAGLBSA-N |
| XLogP | 3.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |