C36H38N2O4 — CID 66923306
1-N,1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclobutane-1,1-dicarboxamide (PubChem CID 66923306) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is 1-N,1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923306 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 1-N,1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclobutane-1,1-dicarboxamide |
| SMILES | C[C@@H](NC(=O)C1(C(=O)N[C@H](C)C(O)(c2ccccc2)c2ccccc2)CCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H38N2O4/c1-26(35(41,28-16-7-3-8-17-28)29-18-9-4-10-19-29)37-32(39)34(24-15-25-34)33(40)38-27(2)36(42,30-20-11-5-12-21-30)31-22-13-6-14-23-31/h3-14,16-23,26-27,41-42H,15,24-25H2,1-2H3,(H,37,39)(H,38,40)/t26-,27-/m1/s1 |
| InChIKey | HVHTYXNFOVTMSE-KAYWLYCHSA-N |
| XLogP | 5.04 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|