C48H62N2O8 — CID 66923991
1-N,1-N'-bis[(2R)-1-hydroxy-1,1-bis(2-methoxyphenyl)-3,3-dimethylbutan-2-yl]cyclohexane-1,1-dicarboxamide (PubChem CID 66923991) has the molecular formula C48H62N2O8 and a molecular weight of 795.03 g/mol. Its IUPAC name is 1-N,1-N'-bis[(2R)-1-hydroxy-1,1-bis(2-methoxyphenyl)-3,3-dimethylbutan-2-yl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(2R)-1-hydroxy-1,1-bis(2-methoxyphenyl)-3,3-dimethylbutan-2-yl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923991 |
| Molecular Formula | C48H62N2O8 |
| Molecular Weight | 795.03 g/mol |
| Exact Mass | 794.45 |
| IUPAC Name | 1-N,1-N'-bis[(2R)-1-hydroxy-1,1-bis(2-methoxyphenyl)-3,3-dimethylbutan-2-yl]cyclohexane-1,1-dicarboxamide |
| SMILES | COc1ccccc1C(O)(c1ccccc1OC)[C@H](NC(=O)C1(C(=O)N[C@H](C(C)(C)C)C(O)(c2ccccc2OC)c2ccccc2OC)CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C48H62N2O8/c1-44(2,3)40(47(53,32-22-12-16-26-36(32)55-7)33-23-13-17-27-37(33)56-8)49-42(51)46(30-20-11-21-31-46)43(52)50-41(45(4,5)6)48(54,34-24-14-18-28-38(34)57-9)35-25-15-19-29-39(35)58-10/h12-19,22-29,40-41,53-54H,11,20-21,30-31H2,1-10H3,(H,49,51)(H,50,52)/t40-,41-/m1/s1 |
| InChIKey | MGOPLXIBVVYFEZ-GYOJGHLZSA-N |
| XLogP | 7.91 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.03 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|