C59H56N2O8 — CID 87160916
1-N,1-N'-bis[(1S)-2-hydroxy-2,2-bis(3-methoxyphenyl)-1-naphthalen-1-ylethyl]cyclopentane-1,1-dicarboxamide (PubChem CID 87160916) has the molecular formula C59H56N2O8 and a molecular weight of 921.10 g/mol. Its IUPAC name is 1-N,1-N'-bis[(1S)-2-hydroxy-2,2-bis(3-methoxyphenyl)-1-naphthalen-1-ylethyl]cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(1S)-2-hydroxy-2,2-bis(3-methoxyphenyl)-1-naphthalen-1-ylethyl]cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 87160916 |
| Molecular Formula | C59H56N2O8 |
| Molecular Weight | 921.10 g/mol |
| Exact Mass | 920.40 |
| IUPAC Name | 1-N,1-N'-bis[(1S)-2-hydroxy-2,2-bis(3-methoxyphenyl)-1-naphthalen-1-ylethyl]cyclopentane-1,1-dicarboxamide |
| SMILES | COc1cccc(C(O)(c2cccc(OC)c2)[C@@H](NC(=O)C2(C(=O)N[C@@H](c3cccc4ccccc34)C(O)(c3cccc(OC)c3)c3cccc(OC)c3)CCCC2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C59H56N2O8/c1-66-45-25-13-21-41(35-45)58(64,42-22-14-26-46(36-42)67-2)53(51-31-11-19-39-17-5-7-29-49(39)51)60-55(62)57(33-9-10-34-57)56(63)61-54(52-32-12-20-40-18-6-8-30-50(40)52)59(65,43-23-15-27-47(37-43)68-3)44-24-16-28-48(38-44)69-4/h5-8,11-32,35-38,53-54,64-65H,9-10,33-34H2,1-4H3,(H,60,62)(H,61,63)/t53-,54-/m0/s1 |
| InChIKey | JMIFWFCVEAOEIA-PJYGOTMFSA-N |
| XLogP | 10.47 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.10 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|