C41H48N2O4 — CID 66807911
1-N,1-N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide (PubChem CID 66807911) has the molecular formula C41H48N2O4 and a molecular weight of 632.85 g/mol. Its IUPAC name is 1-N,1-N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66807911 |
| Molecular Formula | C41H48N2O4 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | 1-N,1-N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide |
| SMILES | O=C(N[C@@H](c1cccc2ccccc12)C1(O)CCCCC1)C1(C(=O)N[C@@H](c2cccc3ccccc23)C2(O)CCCCC2)CCCC1 |
| InChI | InChI=1S/C41H48N2O4/c44-37(42-35(40(46)25-7-1-8-26-40)33-21-13-17-29-15-3-5-19-31(29)33)39(23-11-12-24-39)38(45)43-36(41(47)27-9-2-10-28-41)34-22-14-18-30-16-4-6-20-32(30)34/h3-6,13-22,35-36,46-47H,1-2,7-12,23-28H2,(H,42,44)(H,43,45)/t35-,36-/m0/s1 |
| InChIKey | WLQKGLHCPLXFFE-ZPGRZCPFSA-N |
| XLogP | 7.96 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|